About [2-bis(4-methoxy-3,5-dimethylphenyl)phosphanylcyclopentyl]-dichlorophosphane
[2-bis(4-methoxy-3,5-dimethylphenyl)phosphanylcyclopentyl]-dichlorophosphane (PubChem CID 58900679) has the molecular formula C23H30Cl2O2P2
and a molecular weight of 471.35 g/mol. Its IUPAC name is [2-bis(4-methoxy-3,5-dimethylphenyl)phosphanylcyclopentyl]-dichlorophosphane.
Molecular Properties
| Compound Name | [2-bis(4-methoxy-3,5-dimethylphenyl)phosphanylcyclopentyl]-dichlorophosphane |
| PubChem CID | 58900679 |
| Molecular Formula | C23H30Cl2O2P2 |
| Molecular Weight | 471.35 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | [2-bis(4-methoxy-3,5-dimethylphenyl)phosphanylcyclopentyl]-dichlorophosphane |
| SMILES | COc1c(C)cc(P(c2cc(C)c(OC)c(C)c2)C2CCCC2P(Cl)Cl)cc1C |
| InChI | InChI=1S/C23H30Cl2O2P2/c1-14-10-18(11-15(2)22(14)26-5)28(20-8-7-9-21(20)29(24)25)19-12-16(3)23(27-6)17(4)13-19/h10-13,20-21H,7-9H2,1-6H3 |
| InChIKey | YAJCXWHNIQYYTB-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 471.35 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2-bis(4-methoxy-3,5-dimethylphenyl)phosphanylcyclopentyl]-dichlorophosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-bis(4-methoxy-3,5-dimethylphenyl)phosphanylcyclopentyl]-dichlorophosphane?
The IUPAC name of [2-bis(4-methoxy-3,5-dimethylphenyl)phosphanylcyclopentyl]-dichlorophosphane (CID 58900679) is [2-bis(4-methoxy-3,5-dimethylphenyl)phosphanylcyclopentyl]-dichlorophosphane.
What is the SMILES notation for [2-bis(4-methoxy-3,5-dimethylphenyl)phosphanylcyclopentyl]-dichlorophosphane?
The canonical SMILES for [2-bis(4-methoxy-3,5-dimethylphenyl)phosphanylcyclopentyl]-dichlorophosphane is COc1c(C)cc(P(c2cc(C)c(OC)c(C)c2)C2CCCC2P(Cl)Cl)cc1C.
What is the InChIKey of [2-bis(4-methoxy-3,5-dimethylphenyl)phosphanylcyclopentyl]-dichlorophosphane?
The InChIKey is YAJCXWHNIQYYTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30Cl2O2P2/c1-14-10-18(11-15(2)22(14)26-5)28(20-8-7-9-21(20)29(24)25)19-12-16(3)23(27-6)17(4)13-19/h10-13,20-21H,7-9H2,1-6H3.
What are the key properties of [2-bis(4-methoxy-3,5-dimethylphenyl)phosphanylcyclopentyl]-dichlorophosphane?
[2-bis(4-methoxy-3,5-dimethylphenyl)phosphanylcyclopentyl]-dichlorophosphane has a molecular weight of 471.35 g/mol, XLogP of 7.08, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-bis(4-methoxy-3,5-dimethylphenyl)phosphanylcyclopentyl]-dichlorophosphane is sourced from PubChem (CID 58900679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).