C25H44O6 — CID 58900742
(6S,8R)-10-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-6,8,10-trimethyl-7-(oxan-2-yloxy)undecane-2,9-dione (PubChem CID 58900742) has the molecular formula C25H44O6 and a molecular weight of 440.62 g/mol. Its IUPAC name is (6S,8R)-10-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-6,8,10-trimethyl-7-(oxan-2-yloxy)undecane-2,9-dione.
| Compound Name | (6S,8R)-10-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-6,8,10-trimethyl-7-(oxan-2-yloxy)undecane-2,9-dione |
|---|---|
| PubChem CID | 58900742 |
| Molecular Formula | C25H44O6 |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.31 |
| IUPAC Name | (6S,8R)-10-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-6,8,10-trimethyl-7-(oxan-2-yloxy)undecane-2,9-dione |
| SMILES | CC(=O)CCC[C@H](C)C(OC1CCCCO1)[C@@H](C)C(=O)C(C)(C)[C@@H]1CCOC(C)(C)O1 |
| InChI | InChI=1S/C25H44O6/c1-17(11-10-12-18(2)26)22(30-21-13-8-9-15-28-21)19(3)23(27)24(4,5)20-14-16-29-25(6,7)31-20/h17,19-22H,8-16H2,1-7H3/t17-,19+,20-,21?,22?/m0/s1 |
| InChIKey | VVBGISGQDXRHNJ-FJIBFGEGSA-N |
| XLogP | 5.07 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |