C26H46O6 — CID 58900746
(6S,8R)-10-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-8-ethyl-6,10-dimethyl-7-(oxan-2-yloxy)undecane-2,9-dione (PubChem CID 58900746) has the molecular formula C26H46O6 and a molecular weight of 454.65 g/mol. Its IUPAC name is (6S,8R)-10-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-8-ethyl-6,10-dimethyl-7-(oxan-2-yloxy)undecane-2,9-dione.
| Compound Name | (6S,8R)-10-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-8-ethyl-6,10-dimethyl-7-(oxan-2-yloxy)undecane-2,9-dione |
|---|---|
| PubChem CID | 58900746 |
| Molecular Formula | C26H46O6 |
| Molecular Weight | 454.65 g/mol |
| Exact Mass | 454.33 |
| IUPAC Name | (6S,8R)-10-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-8-ethyl-6,10-dimethyl-7-(oxan-2-yloxy)undecane-2,9-dione |
| SMILES | CC[C@@H](C(=O)C(C)(C)[C@@H]1CCOC(C)(C)O1)C(OC1CCCCO1)[C@@H](C)CCCC(C)=O |
| InChI | InChI=1S/C26H46O6/c1-8-20(24(28)25(4,5)21-15-17-30-26(6,7)32-21)23(18(2)12-11-13-19(3)27)31-22-14-9-10-16-29-22/h18,20-23H,8-17H2,1-7H3/t18-,20+,21-,22?,23?/m0/s1 |
| InChIKey | YXINDKOKURYFIH-GOCGEASNSA-N |
| XLogP | 5.46 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.65 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |