About [5-oxo-2,2-bis(prop-2-enoyloxymethyl)hept-6-enyl] prop-2-enoate
[5-oxo-2,2-bis(prop-2-enoyloxymethyl)hept-6-enyl] prop-2-enoate (PubChem CID 58900824) has the molecular formula C18H22O7
and a molecular weight of 350.37 g/mol. Its IUPAC name is [5-oxo-2,2-bis(prop-2-enoyloxymethyl)hept-6-enyl] prop-2-enoate.
Molecular Properties
| Compound Name | [5-oxo-2,2-bis(prop-2-enoyloxymethyl)hept-6-enyl] prop-2-enoate |
| PubChem CID | 58900824 |
| Molecular Formula | C18H22O7 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | [5-oxo-2,2-bis(prop-2-enoyloxymethyl)hept-6-enyl] prop-2-enoate |
| SMILES | C=CC(=O)CCC(COC(=O)C=C)(COC(=O)C=C)COC(=O)C=C |
| InChI | InChI=1S/C18H22O7/c1-5-14(19)9-10-18(11-23-15(20)6-2,12-24-16(21)7-3)13-25-17(22)8-4/h5-8H,1-4,9-13H2 |
| InChIKey | CDWKOWKZXXBNON-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [5-oxo-2,2-bis(prop-2-enoyloxymethyl)hept-6-enyl] prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-oxo-2,2-bis(prop-2-enoyloxymethyl)hept-6-enyl] prop-2-enoate?
The IUPAC name of [5-oxo-2,2-bis(prop-2-enoyloxymethyl)hept-6-enyl] prop-2-enoate (CID 58900824) is [5-oxo-2,2-bis(prop-2-enoyloxymethyl)hept-6-enyl] prop-2-enoate.
What is the SMILES notation for [5-oxo-2,2-bis(prop-2-enoyloxymethyl)hept-6-enyl] prop-2-enoate?
The canonical SMILES for [5-oxo-2,2-bis(prop-2-enoyloxymethyl)hept-6-enyl] prop-2-enoate is C=CC(=O)CCC(COC(=O)C=C)(COC(=O)C=C)COC(=O)C=C.
What is the InChIKey of [5-oxo-2,2-bis(prop-2-enoyloxymethyl)hept-6-enyl] prop-2-enoate?
The InChIKey is CDWKOWKZXXBNON-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22O7/c1-5-14(19)9-10-18(11-23-15(20)6-2,12-24-16(21)7-3)13-25-17(22)8-4/h5-8H,1-4,9-13H2.
What are the key properties of [5-oxo-2,2-bis(prop-2-enoyloxymethyl)hept-6-enyl] prop-2-enoate?
[5-oxo-2,2-bis(prop-2-enoyloxymethyl)hept-6-enyl] prop-2-enoate has a molecular weight of 350.37 g/mol, XLogP of 1.70, 13 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [5-oxo-2,2-bis(prop-2-enoyloxymethyl)hept-6-enyl] prop-2-enoate is sourced from PubChem (CID 58900824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).