C10H17F7N2O2S — CID 58901110
N-[3-(dimethylamino)propyl]-3,4,4,4-tetrafluoro-3-(trifluoromethyl)butane-1-sulfonamide (PubChem CID 58901110) has the molecular formula C10H17F7N2O2S and a molecular weight of 362.31 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-3,4,4,4-tetrafluoro-3-(trifluoromethyl)butane-1-sulfonamide.
| Compound Name | N-[3-(dimethylamino)propyl]-3,4,4,4-tetrafluoro-3-(trifluoromethyl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 58901110 |
| Molecular Formula | C10H17F7N2O2S |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-3,4,4,4-tetrafluoro-3-(trifluoromethyl)butane-1-sulfonamide |
| SMILES | CN(C)CCCNS(=O)(=O)CCC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H17F7N2O2S/c1-19(2)6-3-5-18-22(20,21)7-4-8(11,9(12,13)14)10(15,16)17/h18H,3-7H2,1-2H3 |
| InChIKey | GQNNGJBGSUPSEI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|