C6H3F10I — CID 58901194
1,1,1,2,5,5,5-heptafluoro-4-iodo-2-(trifluoromethyl)pentane (PubChem CID 58901194) has the molecular formula C6H3F10I and a molecular weight of 391.97 g/mol. Its IUPAC name is 1,1,1,2,5,5,5-heptafluoro-4-iodo-2-(trifluoromethyl)pentane.
| Compound Name | 1,1,1,2,5,5,5-heptafluoro-4-iodo-2-(trifluoromethyl)pentane |
|---|---|
| PubChem CID | 58901194 |
| Molecular Formula | C6H3F10I |
| Molecular Weight | 391.97 g/mol |
| Exact Mass | 391.91 |
| IUPAC Name | 1,1,1,2,5,5,5-heptafluoro-4-iodo-2-(trifluoromethyl)pentane |
| SMILES | FC(F)(F)C(I)CC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H3F10I/c7-3(5(11,12)13,6(14,15)16)1-2(17)4(8,9)10/h2H,1H2 |
| InChIKey | IFPFCMSUTLBECN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.97 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|