C15H16F14 — CID 58901199
9,10,10,10-tetrafluoro-4-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]-9-(trifluoromethyl)dec-1-ene (PubChem CID 58901199) has the molecular formula C15H16F14 and a molecular weight of 462.27 g/mol. Its IUPAC name is 9,10,10,10-tetrafluoro-4-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]-9-(trifluoromethyl)dec-1-ene.
| Compound Name | 9,10,10,10-tetrafluoro-4-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]-9-(trifluoromethyl)dec-1-ene |
|---|---|
| PubChem CID | 58901199 |
| Molecular Formula | C15H16F14 |
| Molecular Weight | 462.27 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 9,10,10,10-tetrafluoro-4-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]-9-(trifluoromethyl)dec-1-ene |
| SMILES | C=CCC(CCCCC(F)(C(F)(F)F)C(F)(F)F)CC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H16F14/c1-2-5-9(8-11(17,14(24,25)26)15(27,28)29)6-3-4-7-10(16,12(18,19)20)13(21,22)23/h2,9H,1,3-8H2 |
| InChIKey | SCJXQJGYLWFNHE-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.27 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|