C9H11F7O2S — CID 58901236
methyl 2-[4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl]sulfanylacetate (PubChem CID 58901236) has the molecular formula C9H11F7O2S and a molecular weight of 316.24 g/mol. Its IUPAC name is methyl 2-[4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl]sulfanylacetate.
| Compound Name | methyl 2-[4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl]sulfanylacetate |
|---|---|
| PubChem CID | 58901236 |
| Molecular Formula | C9H11F7O2S |
| Molecular Weight | 316.24 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | methyl 2-[4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl]sulfanylacetate |
| SMILES | COC(=O)CSCCCC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H11F7O2S/c1-18-6(17)5-19-4-2-3-7(10,8(11,12)13)9(14,15)16/h2-5H2,1H3 |
| InChIKey | NQXNJLVWIPDIEG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.24 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|