About 3-(methanesulfonamido)-N,N-dimethylpropan-1-amine oxide
3-(methanesulfonamido)-N,N-dimethylpropan-1-amine oxide (PubChem CID 58901237) has the molecular formula C6H16N2O3S
and a molecular weight of 196.27 g/mol. Its IUPAC name is 3-(methanesulfonamido)-N,N-dimethylpropan-1-amine oxide.
Molecular Properties
| Compound Name | 3-(methanesulfonamido)-N,N-dimethylpropan-1-amine oxide |
| PubChem CID | 58901237 |
| Molecular Formula | C6H16N2O3S |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | 3-(methanesulfonamido)-N,N-dimethylpropan-1-amine oxide |
| SMILES | C[N+](C)([O-])CCCNS(C)(=O)=O |
| InChI | InChI=1S/C6H16N2O3S/c1-8(2,9)6-4-5-7-12(3,10)11/h7H,4-6H2,1-3H3 |
| InChIKey | HFWGDAAHMNYZPV-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(methanesulfonamido)-N,N-dimethylpropan-1-amine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(methanesulfonamido)-N,N-dimethylpropan-1-amine oxide?
The IUPAC name of 3-(methanesulfonamido)-N,N-dimethylpropan-1-amine oxide (CID 58901237) is 3-(methanesulfonamido)-N,N-dimethylpropan-1-amine oxide.
What is the SMILES notation for 3-(methanesulfonamido)-N,N-dimethylpropan-1-amine oxide?
The canonical SMILES for 3-(methanesulfonamido)-N,N-dimethylpropan-1-amine oxide is C[N+](C)([O-])CCCNS(C)(=O)=O.
What is the InChIKey of 3-(methanesulfonamido)-N,N-dimethylpropan-1-amine oxide?
The InChIKey is HFWGDAAHMNYZPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16N2O3S/c1-8(2,9)6-4-5-7-12(3,10)11/h7H,4-6H2,1-3H3.
What are the key properties of 3-(methanesulfonamido)-N,N-dimethylpropan-1-amine oxide?
3-(methanesulfonamido)-N,N-dimethylpropan-1-amine oxide has a molecular weight of 196.27 g/mol, XLogP of -0.50, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(methanesulfonamido)-N,N-dimethylpropan-1-amine oxide is sourced from PubChem (CID 58901237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).