C12H8F16 — CID 58901252
6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoro-4-(trifluoromethyl)undec-1-ene (PubChem CID 58901252) has the molecular formula C12H8F16 and a molecular weight of 456.16 g/mol. Its IUPAC name is 6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoro-4-(trifluoromethyl)undec-1-ene.
| Compound Name | 6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoro-4-(trifluoromethyl)undec-1-ene |
|---|---|
| PubChem CID | 58901252 |
| Molecular Formula | C12H8F16 |
| Molecular Weight | 456.16 g/mol |
| Exact Mass | 456.04 |
| IUPAC Name | 6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoro-4-(trifluoromethyl)undec-1-ene |
| SMILES | C=CCC(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H8F16/c1-2-3-5(7(15,16)17)4-6(13,14)8(18,19)9(20,21)10(22,23)11(24,25)12(26,27)28/h2,5H,1,3-4H2 |
| InChIKey | HUPKCURNMKFRQV-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.16 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|