About (E)-N-tert-butyl-5,5-dimethylhex-2-enamide
(E)-N-tert-butyl-5,5-dimethylhex-2-enamide (PubChem CID 58901417) has the molecular formula C12H23NO
and a molecular weight of 197.32 g/mol. Its IUPAC name is (E)-N-tert-butyl-5,5-dimethylhex-2-enamide.
Molecular Properties
| Compound Name | (E)-N-tert-butyl-5,5-dimethylhex-2-enamide |
| PubChem CID | 58901417 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | (E)-N-tert-butyl-5,5-dimethylhex-2-enamide |
| SMILES | CC(C)(C)C/C=C/C(=O)NC(C)(C)C |
| InChI | InChI=1S/C12H23NO/c1-11(2,3)9-7-8-10(14)13-12(4,5)6/h7-8H,9H2,1-6H3,(H,13,14)/b8-7+ |
| InChIKey | IPCMKHKJIQYYOZ-BQYQJAHWSA-N |
| XLogP | 2.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-tert-butyl-5,5-dimethylhex-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-tert-butyl-5,5-dimethylhex-2-enamide?
The IUPAC name of (E)-N-tert-butyl-5,5-dimethylhex-2-enamide (CID 58901417) is (E)-N-tert-butyl-5,5-dimethylhex-2-enamide.
What is the SMILES notation for (E)-N-tert-butyl-5,5-dimethylhex-2-enamide?
The canonical SMILES for (E)-N-tert-butyl-5,5-dimethylhex-2-enamide is CC(C)(C)C/C=C/C(=O)NC(C)(C)C.
What is the InChIKey of (E)-N-tert-butyl-5,5-dimethylhex-2-enamide?
The InChIKey is IPCMKHKJIQYYOZ-BQYQJAHWSA-N. The full InChI is InChI=1S/C12H23NO/c1-11(2,3)9-7-8-10(14)13-12(4,5)6/h7-8H,9H2,1-6H3,(H,13,14)/b8-7+.
What are the key properties of (E)-N-tert-butyl-5,5-dimethylhex-2-enamide?
(E)-N-tert-butyl-5,5-dimethylhex-2-enamide has a molecular weight of 197.32 g/mol, XLogP of 2.89, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-tert-butyl-5,5-dimethylhex-2-enamide is sourced from PubChem (CID 58901417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).