About 4a,5,8,8a-tetrahydroquinoxaline
4a,5,8,8a-tetrahydroquinoxaline (PubChem CID 58901459) has the molecular formula C8H10N2
and a molecular weight of 134.18 g/mol. Its IUPAC name is 4a,5,8,8a-tetrahydroquinoxaline.
Molecular Properties
| Compound Name | 4a,5,8,8a-tetrahydroquinoxaline |
| PubChem CID | 58901459 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | 4a,5,8,8a-tetrahydroquinoxaline |
| SMILES | C1=CCC2N=CC=NC2C1 |
| InChI | InChI=1S/C8H10N2/c1-2-4-8-7(3-1)9-5-6-10-8/h1-2,5-8H,3-4H2 |
| InChIKey | UDBWKNJXBCPZAU-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4a,5,8,8a-tetrahydroquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4a,5,8,8a-tetrahydroquinoxaline?
The IUPAC name of 4a,5,8,8a-tetrahydroquinoxaline (CID 58901459) is 4a,5,8,8a-tetrahydroquinoxaline.
What is the SMILES notation for 4a,5,8,8a-tetrahydroquinoxaline?
The canonical SMILES for 4a,5,8,8a-tetrahydroquinoxaline is C1=CCC2N=CC=NC2C1.
What is the InChIKey of 4a,5,8,8a-tetrahydroquinoxaline?
The InChIKey is UDBWKNJXBCPZAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2/c1-2-4-8-7(3-1)9-5-6-10-8/h1-2,5-8H,3-4H2.
What are the key properties of 4a,5,8,8a-tetrahydroquinoxaline?
4a,5,8,8a-tetrahydroquinoxaline has a molecular weight of 134.18 g/mol, XLogP of 1.23, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4a,5,8,8a-tetrahydroquinoxaline is sourced from PubChem (CID 58901459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).