C25H16N6O3 — CID 58901521
(17R)-16-azido-17-hydroxy-4,14,19-triazaoctacyclo[12.11.2.115,18.02,6.07,27.08,13.019,26.020,25]octacosa-1,6,8,10,12,20,22,24,26-nonaene-3,5-dione (PubChem CID 58901521) has the molecular formula C25H16N6O3 and a molecular weight of 448.44 g/mol. Its IUPAC name is (17R)-16-azido-17-hydroxy-4,14,19-triazaoctacyclo[12.11.2.115,18.02,6.07,27.08,13.019,26.020,25]octacosa-1,6,8,10,12,20,22,24,26-nonaene-3,5-dione.
| Compound Name | (17R)-16-azido-17-hydroxy-4,14,19-triazaoctacyclo[12.11.2.115,18.02,6.07,27.08,13.019,26.020,25]octacosa-1,6,8,10,12,20,22,24,26-nonaene-3,5-dione |
|---|---|
| PubChem CID | 58901521 |
| Molecular Formula | C25H16N6O3 |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | (17R)-16-azido-17-hydroxy-4,14,19-triazaoctacyclo[12.11.2.115,18.02,6.07,27.08,13.019,26.020,25]octacosa-1,6,8,10,12,20,22,24,26-nonaene-3,5-dione |
| SMILES | [N-]=[N+]=NC1C2CC([C@H]1O)n1c3ccccc3c3c4c(c5c6ccccc6n2c5c31)C(=O)NC4=O |
| InChI | InChI=1S/C25H16N6O3/c26-29-28-20-14-9-15(23(20)32)31-13-8-4-2-6-11(13)17-19-18(24(33)27-25(19)34)16-10-5-1-3-7-12(10)30(14)21(16)22(17)31/h1-8,14-15,20,23,32H,9H2,(H,27,33,34)/t14?,15?,20?,23-/m1/s1 |
| InChIKey | XSSXJOIEVFSCAZ-BVDHZKCNSA-N |
| XLogP | 4.33 |
| TPSA | 125.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|