About 6,11-dihydropyrido[2,3-b][1]benzazepin-5-one
6,11-dihydropyrido[2,3-b][1]benzazepin-5-one (PubChem CID 58901622) has the molecular formula C13H10N2O
and a molecular weight of 210.24 g/mol. Its IUPAC name is 6,11-dihydropyrido[2,3-b][1]benzazepin-5-one.
Molecular Properties
| Compound Name | 6,11-dihydropyrido[2,3-b][1]benzazepin-5-one |
| PubChem CID | 58901622 |
| Molecular Formula | C13H10N2O |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 6,11-dihydropyrido[2,3-b][1]benzazepin-5-one |
| SMILES | O=C1Cc2ccccc2Nc2ncccc21 |
| InChI | InChI=1S/C13H10N2O/c16-12-8-9-4-1-2-6-11(9)15-13-10(12)5-3-7-14-13/h1-7H,8H2,(H,14,15) |
| InChIKey | LQQASBXXQXVPRI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,11-dihydropyrido[2,3-b][1]benzazepin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,11-dihydropyrido[2,3-b][1]benzazepin-5-one?
The IUPAC name of 6,11-dihydropyrido[2,3-b][1]benzazepin-5-one (CID 58901622) is 6,11-dihydropyrido[2,3-b][1]benzazepin-5-one.
What is the SMILES notation for 6,11-dihydropyrido[2,3-b][1]benzazepin-5-one?
The canonical SMILES for 6,11-dihydropyrido[2,3-b][1]benzazepin-5-one is O=C1Cc2ccccc2Nc2ncccc21.
What is the InChIKey of 6,11-dihydropyrido[2,3-b][1]benzazepin-5-one?
The InChIKey is LQQASBXXQXVPRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O/c16-12-8-9-4-1-2-6-11(9)15-13-10(12)5-3-7-14-13/h1-7H,8H2,(H,14,15).
What are the key properties of 6,11-dihydropyrido[2,3-b][1]benzazepin-5-one?
6,11-dihydropyrido[2,3-b][1]benzazepin-5-one has a molecular weight of 210.24 g/mol, XLogP of 2.56, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,11-dihydropyrido[2,3-b][1]benzazepin-5-one is sourced from PubChem (CID 58901622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).