About 1-methylphthalazine
1-methylphthalazine (PubChem CID 589029) has the molecular formula C9H8N2
and a molecular weight of 144.18 g/mol. Its IUPAC name is 1-methylphthalazine.
Molecular Properties
| Compound Name | 1-methylphthalazine |
| PubChem CID | 589029 |
| Molecular Formula | C9H8N2 |
| Molecular Weight | 144.18 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | 1-methylphthalazine |
| SMILES | Cc1nncc2ccccc12 |
| InChI | InChI=1S/C9H8N2/c1-7-9-5-3-2-4-8(9)6-10-11-7/h2-6H,1H3 |
| InChIKey | VXDPPGNAYZJZPM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.18 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methylphthalazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylphthalazine?
The IUPAC name of 1-methylphthalazine (CID 589029) is 1-methylphthalazine.
What is the SMILES notation for 1-methylphthalazine?
The canonical SMILES for 1-methylphthalazine is Cc1nncc2ccccc12.
What is the InChIKey of 1-methylphthalazine?
The InChIKey is VXDPPGNAYZJZPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2/c1-7-9-5-3-2-4-8(9)6-10-11-7/h2-6H,1H3.
What are the key properties of 1-methylphthalazine?
1-methylphthalazine has a molecular weight of 144.18 g/mol, XLogP of 1.94, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylphthalazine is sourced from PubChem (CID 589029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).