About [(E,2S)-4-methylhex-4-en-2-yl]oxy-tri(propan-2-yl)silane
[(E,2S)-4-methylhex-4-en-2-yl]oxy-tri(propan-2-yl)silane (PubChem CID 58902915) has the molecular formula C16H34OSi
and a molecular weight of 270.53 g/mol. Its IUPAC name is [(E,2S)-4-methylhex-4-en-2-yl]oxy-tri(propan-2-yl)silane.
Molecular Properties
| Compound Name | [(E,2S)-4-methylhex-4-en-2-yl]oxy-tri(propan-2-yl)silane |
| PubChem CID | 58902915 |
| Molecular Formula | C16H34OSi |
| Molecular Weight | 270.53 g/mol |
| Exact Mass | 270.24 |
| IUPAC Name | [(E,2S)-4-methylhex-4-en-2-yl]oxy-tri(propan-2-yl)silane |
| SMILES | C/C=C(\C)C[C@H](C)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C16H34OSi/c1-10-15(8)11-16(9)17-18(12(2)3,13(4)5)14(6)7/h10,12-14,16H,11H2,1-9H3/b15-10+/t16-/m0/s1 |
| InChIKey | FPDFDOWLTHIPDS-KMPOOHAWSA-N |
| XLogP | 5.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.53 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E,2S)-4-methylhex-4-en-2-yl]oxy-tri(propan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E,2S)-4-methylhex-4-en-2-yl]oxy-tri(propan-2-yl)silane?
The IUPAC name of [(E,2S)-4-methylhex-4-en-2-yl]oxy-tri(propan-2-yl)silane (CID 58902915) is [(E,2S)-4-methylhex-4-en-2-yl]oxy-tri(propan-2-yl)silane.
What is the SMILES notation for [(E,2S)-4-methylhex-4-en-2-yl]oxy-tri(propan-2-yl)silane?
The canonical SMILES for [(E,2S)-4-methylhex-4-en-2-yl]oxy-tri(propan-2-yl)silane is C/C=C(\C)C[C@H](C)O[Si](C(C)C)(C(C)C)C(C)C.
What is the InChIKey of [(E,2S)-4-methylhex-4-en-2-yl]oxy-tri(propan-2-yl)silane?
The InChIKey is FPDFDOWLTHIPDS-KMPOOHAWSA-N. The full InChI is InChI=1S/C16H34OSi/c1-10-15(8)11-16(9)17-18(12(2)3,13(4)5)14(6)7/h10,12-14,16H,11H2,1-9H3/b15-10+/t16-/m0/s1.
What are the key properties of [(E,2S)-4-methylhex-4-en-2-yl]oxy-tri(propan-2-yl)silane?
[(E,2S)-4-methylhex-4-en-2-yl]oxy-tri(propan-2-yl)silane has a molecular weight of 270.53 g/mol, XLogP of 5.92, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(E,2S)-4-methylhex-4-en-2-yl]oxy-tri(propan-2-yl)silane is sourced from PubChem (CID 58902915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).