C10H10F6 — CID 589036
1,4,5,5,6,6-hexafluoro-2,3-dimethylbicyclo[2.2.2]oct-2-ene (PubChem CID 589036) has the molecular formula C10H10F6 and a molecular weight of 244.18 g/mol. Its IUPAC name is 1,4,5,5,6,6-hexafluoro-2,3-dimethylbicyclo[2.2.2]oct-2-ene.
| Compound Name | 1,4,5,5,6,6-hexafluoro-2,3-dimethylbicyclo[2.2.2]oct-2-ene |
|---|---|
| PubChem CID | 589036 |
| Molecular Formula | C10H10F6 |
| Molecular Weight | 244.18 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 1,4,5,5,6,6-hexafluoro-2,3-dimethylbicyclo[2.2.2]oct-2-ene |
| SMILES | CC1=C(C)C2(F)CCC1(F)C(F)(F)C2(F)F |
| InChI | InChI=1S/C10H10F6/c1-5-6(2)8(12)4-3-7(5,11)9(13,14)10(8,15)16/h3-4H2,1-2H3 |
| InChIKey | FURUEAPUALHWOC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.18 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|