C22H37N5O5 — CID 58903921
1-[6-(isocyanatomethyl)-4,7,10-tris(2-oxopropyl)-1,4,7,10-tetrazacyclododec-1-yl]propan-2-one (PubChem CID 58903921) has the molecular formula C22H37N5O5 and a molecular weight of 451.57 g/mol. Its IUPAC name is 1-[6-(isocyanatomethyl)-4,7,10-tris(2-oxopropyl)-1,4,7,10-tetrazacyclododec-1-yl]propan-2-one.
| Compound Name | 1-[6-(isocyanatomethyl)-4,7,10-tris(2-oxopropyl)-1,4,7,10-tetrazacyclododec-1-yl]propan-2-one |
|---|---|
| PubChem CID | 58903921 |
| Molecular Formula | C22H37N5O5 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.28 |
| IUPAC Name | 1-[6-(isocyanatomethyl)-4,7,10-tris(2-oxopropyl)-1,4,7,10-tetrazacyclododec-1-yl]propan-2-one |
| SMILES | CC(=O)CN1CCN(CC(C)=O)CCN(CC(C)=O)C(CN=C=O)CN(CC(C)=O)CC1 |
| InChI | InChI=1S/C22H37N5O5/c1-18(29)12-24-5-6-25(13-19(2)30)9-10-27(15-21(4)32)22(11-23-17-28)16-26(8-7-24)14-20(3)31/h22H,5-16H2,1-4H3 |
| InChIKey | KOYVJTBMLNXHFT-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 110.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|