C36H32IrN2O2-2 — CID 58904123
(Z)-4-(4-but-2-en-2-ylphenyl)-4-hydroxybut-3-en-2-one;iridium;bis(2-phenylpyridine) (PubChem CID 58904123) has the molecular formula C36H32IrN2O2-2 and a molecular weight of 716.88 g/mol. Its IUPAC name is (Z)-4-(4-but-2-en-2-ylphenyl)-4-hydroxybut-3-en-2-one;iridium;bis(2-phenylpyridine).
| Compound Name | (Z)-4-(4-but-2-en-2-ylphenyl)-4-hydroxybut-3-en-2-one;iridium;bis(2-phenylpyridine) |
|---|---|
| PubChem CID | 58904123 |
| Molecular Formula | C36H32IrN2O2-2 |
| Molecular Weight | 716.88 g/mol |
| Exact Mass | 717.21 |
| IUPAC Name | (Z)-4-(4-but-2-en-2-ylphenyl)-4-hydroxybut-3-en-2-one;iridium;bis(2-phenylpyridine) |
| SMILES | CC=C(C)c1ccc(/C(O)=C/C(C)=O)cc1.[Ir].[c-]1ccccc1-c1ccccn1.[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C14H16O2.2C11H8N.Ir/c1-4-10(2)12-5-7-13(8-6-12)14(16)9-11(3)15;2*1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h4-9,16H,1-3H3;2*1-6,8-9H;/q;2*-1;/b10-4?,14-9-;;; |
| InChIKey | BAOSHIYMAASQGV-ZPZOYTTDSA-N |
| XLogP | 8.69 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.88 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|