About 2-(5-methyl-1,3-thiazol-4-yl)ethyl 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate
2-(5-methyl-1,3-thiazol-4-yl)ethyl 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate (PubChem CID 58904886) has the molecular formula C17H16N4O2S2
and a molecular weight of 372.48 g/mol. Its IUPAC name is 2-(5-methyl-1,3-thiazol-4-yl)ethyl 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate.
Molecular Properties
| Compound Name | 2-(5-methyl-1,3-thiazol-4-yl)ethyl 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate |
| PubChem CID | 58904886 |
| Molecular Formula | C17H16N4O2S2 |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 2-(5-methyl-1,3-thiazol-4-yl)ethyl 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate |
| SMILES | Cc1scnc1CCOC(=O)CSc1nccc(-c2ccccn2)n1 |
| InChI | InChI=1S/C17H16N4O2S2/c1-12-13(20-11-25-12)6-9-23-16(22)10-24-17-19-8-5-15(21-17)14-4-2-3-7-18-14/h2-5,7-8,11H,6,9-10H2,1H3 |
| InChIKey | GLAQHGRCJSGYOI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 77.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-(5-methyl-1,3-thiazol-4-yl)ethyl 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-methyl-1,3-thiazol-4-yl)ethyl 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate?
The IUPAC name of 2-(5-methyl-1,3-thiazol-4-yl)ethyl 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate (CID 58904886) is 2-(5-methyl-1,3-thiazol-4-yl)ethyl 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate.
What is the SMILES notation for 2-(5-methyl-1,3-thiazol-4-yl)ethyl 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate?
The canonical SMILES for 2-(5-methyl-1,3-thiazol-4-yl)ethyl 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate is Cc1scnc1CCOC(=O)CSc1nccc(-c2ccccn2)n1.
What is the InChIKey of 2-(5-methyl-1,3-thiazol-4-yl)ethyl 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate?
The InChIKey is GLAQHGRCJSGYOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N4O2S2/c1-12-13(20-11-25-12)6-9-23-16(22)10-24-17-19-8-5-15(21-17)14-4-2-3-7-18-14/h2-5,7-8,11H,6,9-10H2,1H3.
What are the key properties of 2-(5-methyl-1,3-thiazol-4-yl)ethyl 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate?
2-(5-methyl-1,3-thiazol-4-yl)ethyl 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate has a molecular weight of 372.48 g/mol, XLogP of 3.18, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methyl-1,3-thiazol-4-yl)ethyl 2-(4-pyridin-2-ylpyrimidin-2-yl)sulfanylacetate is sourced from PubChem (CID 58904886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).