About 6-(2,4-difluorophenoxy)-N-(4-methylsulfonylcyclohexyl)quinazolin-2-amine
6-(2,4-difluorophenoxy)-N-(4-methylsulfonylcyclohexyl)quinazolin-2-amine (PubChem CID 58905139) has the molecular formula C21H21F2N3O3S
and a molecular weight of 433.48 g/mol. Its IUPAC name is 6-(2,4-difluorophenoxy)-N-(4-methylsulfonylcyclohexyl)quinazolin-2-amine.
Molecular Properties
| Compound Name | 6-(2,4-difluorophenoxy)-N-(4-methylsulfonylcyclohexyl)quinazolin-2-amine |
| PubChem CID | 58905139 |
| Molecular Formula | C21H21F2N3O3S |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 6-(2,4-difluorophenoxy)-N-(4-methylsulfonylcyclohexyl)quinazolin-2-amine |
| SMILES | CS(=O)(=O)C1CCC(Nc2ncc3cc(Oc4ccc(F)cc4F)ccc3n2)CC1 |
| InChI | InChI=1S/C21H21F2N3O3S/c1-30(27,28)17-6-3-15(4-7-17)25-21-24-12-13-10-16(5-8-19(13)26-21)29-20-9-2-14(22)11-18(20)23/h2,5,8-12,15,17H,3-4,6-7H2,1H3,(H,24,25,26) |
| InChIKey | XXNIIHBHAYSSEU-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-(2,4-difluorophenoxy)-N-(4-methylsulfonylcyclohexyl)quinazolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,4-difluorophenoxy)-N-(4-methylsulfonylcyclohexyl)quinazolin-2-amine?
The IUPAC name of 6-(2,4-difluorophenoxy)-N-(4-methylsulfonylcyclohexyl)quinazolin-2-amine (CID 58905139) is 6-(2,4-difluorophenoxy)-N-(4-methylsulfonylcyclohexyl)quinazolin-2-amine.
What is the SMILES notation for 6-(2,4-difluorophenoxy)-N-(4-methylsulfonylcyclohexyl)quinazolin-2-amine?
The canonical SMILES for 6-(2,4-difluorophenoxy)-N-(4-methylsulfonylcyclohexyl)quinazolin-2-amine is CS(=O)(=O)C1CCC(Nc2ncc3cc(Oc4ccc(F)cc4F)ccc3n2)CC1.
What is the InChIKey of 6-(2,4-difluorophenoxy)-N-(4-methylsulfonylcyclohexyl)quinazolin-2-amine?
The InChIKey is XXNIIHBHAYSSEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21F2N3O3S/c1-30(27,28)17-6-3-15(4-7-17)25-21-24-12-13-10-16(5-8-19(13)26-21)29-20-9-2-14(22)11-18(20)23/h2,5,8-12,15,17H,3-4,6-7H2,1H3,(H,24,25,26).
What are the key properties of 6-(2,4-difluorophenoxy)-N-(4-methylsulfonylcyclohexyl)quinazolin-2-amine?
6-(2,4-difluorophenoxy)-N-(4-methylsulfonylcyclohexyl)quinazolin-2-amine has a molecular weight of 433.48 g/mol, XLogP of 4.47, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,4-difluorophenoxy)-N-(4-methylsulfonylcyclohexyl)quinazolin-2-amine is sourced from PubChem (CID 58905139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).