C22H18F2N2O4 — CID 58905379
4-[2-[[5-fluoro-2-(4-fluorophenoxy)pyridine-3-carbonyl]amino]propan-2-yl]benzoic acid (PubChem CID 58905379) has the molecular formula C22H18F2N2O4 and a molecular weight of 412.39 g/mol. Its IUPAC name is 4-[2-[[5-fluoro-2-(4-fluorophenoxy)pyridine-3-carbonyl]amino]propan-2-yl]benzoic acid.
| Compound Name | 4-[2-[[5-fluoro-2-(4-fluorophenoxy)pyridine-3-carbonyl]amino]propan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 58905379 |
| Molecular Formula | C22H18F2N2O4 |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 4-[2-[[5-fluoro-2-(4-fluorophenoxy)pyridine-3-carbonyl]amino]propan-2-yl]benzoic acid |
| SMILES | CC(C)(NC(=O)c1cc(F)cnc1Oc1ccc(F)cc1)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C22H18F2N2O4/c1-22(2,14-5-3-13(4-6-14)21(28)29)26-19(27)18-11-16(24)12-25-20(18)30-17-9-7-15(23)8-10-17/h3-12H,1-2H3,(H,26,27)(H,28,29) |
| InChIKey | QJJZGLLIFQDTQD-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |