C17H25N3O5 — CID 58905552
(2S)-2-[[(2S,3S)-3-methyl-2-[(1-oxidopyridin-1-ium-4-carbonyl)amino]pentanoyl]amino]pentanoic acid (PubChem CID 58905552) has the molecular formula C17H25N3O5 and a molecular weight of 351.40 g/mol. Its IUPAC name is (2S)-2-[[(2S,3S)-3-methyl-2-[(1-oxidopyridin-1-ium-4-carbonyl)amino]pentanoyl]amino]pentanoic acid.
| Compound Name | (2S)-2-[[(2S,3S)-3-methyl-2-[(1-oxidopyridin-1-ium-4-carbonyl)amino]pentanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 58905552 |
| Molecular Formula | C17H25N3O5 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | (2S)-2-[[(2S,3S)-3-methyl-2-[(1-oxidopyridin-1-ium-4-carbonyl)amino]pentanoyl]amino]pentanoic acid |
| SMILES | CCC[C@H](NC(=O)[C@@H](NC(=O)c1cc[n+]([O-])cc1)[C@@H](C)CC)C(=O)O |
| InChI | InChI=1S/C17H25N3O5/c1-4-6-13(17(23)24)18-16(22)14(11(3)5-2)19-15(21)12-7-9-20(25)10-8-12/h7-11,13-14H,4-6H2,1-3H3,(H,18,22)(H,19,21)(H,23,24)/t11-,13-,14-/m0/s1 |
| InChIKey | MTSJGDCCQYKFMX-UBHSHLNASA-N |
| XLogP | 0.83 |
| TPSA | 122.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|