C54H69Cl2N2PRu — CID 58905760
1,3-bis(2,4,6-trimethylphenyl)-2H-imidazol-2-ide;dichloro-(3-phenylinden-1-ylidene)ruthenium;tricyclohexylphosphanium (PubChem CID 58905760) has the molecular formula C54H69Cl2N2PRu and a molecular weight of 949.11 g/mol. Its IUPAC name is 1,3-bis(2,4,6-trimethylphenyl)-2H-imidazol-2-ide;dichloro-(3-phenylinden-1-ylidene)ruthenium;tricyclohexylphosphanium.
| Compound Name | 1,3-bis(2,4,6-trimethylphenyl)-2H-imidazol-2-ide;dichloro-(3-phenylinden-1-ylidene)ruthenium;tricyclohexylphosphanium |
|---|---|
| PubChem CID | 58905760 |
| Molecular Formula | C54H69Cl2N2PRu |
| Molecular Weight | 949.11 g/mol |
| Exact Mass | 948.36 |
| IUPAC Name | 1,3-bis(2,4,6-trimethylphenyl)-2H-imidazol-2-ide;dichloro-(3-phenylinden-1-ylidene)ruthenium;tricyclohexylphosphanium |
| SMILES | C1CCC([PH+](C2CCCCC2)C2CCCCC2)CC1.Cc1cc(C)c(N2C=CN(c3c(C)cc(C)cc3C)[CH-]2)c(C)c1.Cl[Ru](Cl)=C1C=C(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C21H25N2.C18H33P.C15H10.2ClH.Ru/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-6-12(7-3-1)15-11-10-13-8-4-5-9-14(13)15;;;/h7-13H,1-6H3;16-18H,1-15H2;1-9,11H;2*1H;/q-1;;;;;+2/p-1 |
| InChIKey | QXVAIYCXHZHFGQ-UHFFFAOYSA-M |
| XLogP | 16.23 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 949.11 |
| LogP ≤ 5 | 16.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|