C45H31F4NO2 — CID 58905943
4-(9,9-diphenylfluoren-2-yl)-2,3,5,6-tetrafluoro-N,N-bis(4-methoxyphenyl)aniline (PubChem CID 58905943) has the molecular formula C45H31F4NO2 and a molecular weight of 693.74 g/mol. Its IUPAC name is 4-(9,9-diphenylfluoren-2-yl)-2,3,5,6-tetrafluoro-N,N-bis(4-methoxyphenyl)aniline.
| Compound Name | 4-(9,9-diphenylfluoren-2-yl)-2,3,5,6-tetrafluoro-N,N-bis(4-methoxyphenyl)aniline |
|---|---|
| PubChem CID | 58905943 |
| Molecular Formula | C45H31F4NO2 |
| Molecular Weight | 693.74 g/mol |
| Exact Mass | 693.23 |
| IUPAC Name | 4-(9,9-diphenylfluoren-2-yl)-2,3,5,6-tetrafluoro-N,N-bis(4-methoxyphenyl)aniline |
| SMILES | COc1ccc(N(c2ccc(OC)cc2)c2c(F)c(F)c(-c3ccc4c(c3)C(c3ccccc3)(c3ccccc3)c3ccccc3-4)c(F)c2F)cc1 |
| InChI | InChI=1S/C45H31F4NO2/c1-51-33-22-18-31(19-23-33)50(32-20-24-34(52-2)25-21-32)44-42(48)40(46)39(41(47)43(44)49)28-17-26-36-35-15-9-10-16-37(35)45(38(36)27-28,29-11-5-3-6-12-29)30-13-7-4-8-14-30/h3-27H,1-2H3 |
| InChIKey | YCAZDKSEFKFHCV-UHFFFAOYSA-N |
| XLogP | 11.76 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.74 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|