About 3-fluoro-1,4-dimethylpyrazole
3-fluoro-1,4-dimethylpyrazole (PubChem CID 58906089) has the molecular formula C5H7FN2
and a molecular weight of 114.12 g/mol. Its IUPAC name is 3-fluoro-1,4-dimethylpyrazole.
Molecular Properties
| Compound Name | 3-fluoro-1,4-dimethylpyrazole |
| PubChem CID | 58906089 |
| Molecular Formula | C5H7FN2 |
| Molecular Weight | 114.12 g/mol |
| Exact Mass | 114.06 |
| IUPAC Name | 3-fluoro-1,4-dimethylpyrazole |
| SMILES | Cc1cn(C)nc1F |
| InChI | InChI=1S/C5H7FN2/c1-4-3-8(2)7-5(4)6/h3H,1-2H3 |
| InChIKey | NYFCQYMJJCADBN-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.12 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-fluoro-1,4-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-1,4-dimethylpyrazole?
The IUPAC name of 3-fluoro-1,4-dimethylpyrazole (CID 58906089) is 3-fluoro-1,4-dimethylpyrazole.
What is the SMILES notation for 3-fluoro-1,4-dimethylpyrazole?
The canonical SMILES for 3-fluoro-1,4-dimethylpyrazole is Cc1cn(C)nc1F.
What is the InChIKey of 3-fluoro-1,4-dimethylpyrazole?
The InChIKey is NYFCQYMJJCADBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7FN2/c1-4-3-8(2)7-5(4)6/h3H,1-2H3.
What are the key properties of 3-fluoro-1,4-dimethylpyrazole?
3-fluoro-1,4-dimethylpyrazole has a molecular weight of 114.12 g/mol, XLogP of 0.87, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-1,4-dimethylpyrazole is sourced from PubChem (CID 58906089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).