About trans-(3R,5R)-4-butylidene-3,5-dihydroxycyclohexan-1-one;tris(yttrium)
trans-(3R,5R)-4-butylidene-3,5-dihydroxycyclohexan-1-one;tris(yttrium) (PubChem CID 58906130) has the molecular formula C10H16O3Y3
and a molecular weight of 450.95 g/mol. Its IUPAC name is trans-(3R,5R)-4-butylidene-3,5-dihydroxycyclohexan-1-one;tris(yttrium).
Molecular Properties
| Compound Name | trans-(3R,5R)-4-butylidene-3,5-dihydroxycyclohexan-1-one;tris(yttrium) |
| PubChem CID | 58906130 |
| Molecular Formula | C10H16O3Y3 |
| Molecular Weight | 450.95 g/mol |
| Exact Mass | 450.83 |
| IUPAC Name | trans-(3R,5R)-4-butylidene-3,5-dihydroxycyclohexan-1-one;tris(yttrium) |
| SMILES | CCCC=C1[C@H](O)CC(=O)C[C@H]1O.[Y].[Y].[Y] |
| InChI | InChI=1S/C10H16O3.3Y/c1-2-3-4-8-9(12)5-7(11)6-10(8)13;;;/h4,9-10,12-13H,2-3,5-6H2,1H3;;;/t9-,10-;;;/m1.../s1 |
| InChIKey | BPFCHNJQNDFONR-JOXSFUCDSA-N |
| XLogP | 0.79 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.95 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze trans-(3R,5R)-4-butylidene-3,5-dihydroxycyclohexan-1-one;tris(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(3R,5R)-4-butylidene-3,5-dihydroxycyclohexan-1-one;tris(yttrium)?
The IUPAC name of trans-(3R,5R)-4-butylidene-3,5-dihydroxycyclohexan-1-one;tris(yttrium) (CID 58906130) is trans-(3R,5R)-4-butylidene-3,5-dihydroxycyclohexan-1-one;tris(yttrium).
What is the SMILES notation for trans-(3R,5R)-4-butylidene-3,5-dihydroxycyclohexan-1-one;tris(yttrium)?
The canonical SMILES for trans-(3R,5R)-4-butylidene-3,5-dihydroxycyclohexan-1-one;tris(yttrium) is CCCC=C1[C@H](O)CC(=O)C[C@H]1O.[Y].[Y].[Y].
What is the InChIKey of trans-(3R,5R)-4-butylidene-3,5-dihydroxycyclohexan-1-one;tris(yttrium)?
The InChIKey is BPFCHNJQNDFONR-JOXSFUCDSA-N. The full InChI is InChI=1S/C10H16O3.3Y/c1-2-3-4-8-9(12)5-7(11)6-10(8)13;;;/h4,9-10,12-13H,2-3,5-6H2,1H3;;;/t9-,10-;;;/m1.../s1.
What are the key properties of trans-(3R,5R)-4-butylidene-3,5-dihydroxycyclohexan-1-one;tris(yttrium)?
trans-(3R,5R)-4-butylidene-3,5-dihydroxycyclohexan-1-one;tris(yttrium) has a molecular weight of 450.95 g/mol, XLogP of 0.79, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(3R,5R)-4-butylidene-3,5-dihydroxycyclohexan-1-one;tris(yttrium) is sourced from PubChem (CID 58906130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).