C23H36N4O2 — CID 58906605
1-(4-butoxyphenyl)-3-[4-[2-(dimethylamino)ethylamino]cyclohexyl]imidazol-2-one (PubChem CID 58906605) has the molecular formula C23H36N4O2 and a molecular weight of 400.57 g/mol. Its IUPAC name is 1-(4-butoxyphenyl)-3-[4-[2-(dimethylamino)ethylamino]cyclohexyl]imidazol-2-one.
| Compound Name | 1-(4-butoxyphenyl)-3-[4-[2-(dimethylamino)ethylamino]cyclohexyl]imidazol-2-one |
|---|---|
| PubChem CID | 58906605 |
| Molecular Formula | C23H36N4O2 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | 1-(4-butoxyphenyl)-3-[4-[2-(dimethylamino)ethylamino]cyclohexyl]imidazol-2-one |
| SMILES | CCCCOc1ccc(-n2ccn(C3CCC(NCCN(C)C)CC3)c2=O)cc1 |
| InChI | InChI=1S/C23H36N4O2/c1-4-5-18-29-22-12-10-21(11-13-22)27-17-16-26(23(27)28)20-8-6-19(7-9-20)24-14-15-25(2)3/h10-13,16-17,19-20,24H,4-9,14-15,18H2,1-3H3 |
| InChIKey | PWPJZUISNFYSTD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 51.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|