About 5-[[5-(3,5-dichlorophenoxy)-4-ethyl-1-propan-2-ylpyrazol-3-yl]methyl]-2H-tetrazole
5-[[5-(3,5-dichlorophenoxy)-4-ethyl-1-propan-2-ylpyrazol-3-yl]methyl]-2H-tetrazole (PubChem CID 58907117) has the molecular formula C16H18Cl2N6O
and a molecular weight of 381.27 g/mol. Its IUPAC name is 5-[[5-(3,5-dichlorophenoxy)-4-ethyl-1-propan-2-ylpyrazol-3-yl]methyl]-2H-tetrazole.
Molecular Properties
| Compound Name | 5-[[5-(3,5-dichlorophenoxy)-4-ethyl-1-propan-2-ylpyrazol-3-yl]methyl]-2H-tetrazole |
| PubChem CID | 58907117 |
| Molecular Formula | C16H18Cl2N6O |
| Molecular Weight | 381.27 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 5-[[5-(3,5-dichlorophenoxy)-4-ethyl-1-propan-2-ylpyrazol-3-yl]methyl]-2H-tetrazole |
| SMILES | CCc1c(Cc2nn[nH]n2)nn(C(C)C)c1Oc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C16H18Cl2N6O/c1-4-13-14(8-15-19-22-23-20-15)21-24(9(2)3)16(13)25-12-6-10(17)5-11(18)7-12/h5-7,9H,4,8H2,1-3H3,(H,19,20,22,23) |
| InChIKey | PYZQRDHNVMYZCF-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.27 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[[5-(3,5-dichlorophenoxy)-4-ethyl-1-propan-2-ylpyrazol-3-yl]methyl]-2H-tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[5-(3,5-dichlorophenoxy)-4-ethyl-1-propan-2-ylpyrazol-3-yl]methyl]-2H-tetrazole?
The IUPAC name of 5-[[5-(3,5-dichlorophenoxy)-4-ethyl-1-propan-2-ylpyrazol-3-yl]methyl]-2H-tetrazole (CID 58907117) is 5-[[5-(3,5-dichlorophenoxy)-4-ethyl-1-propan-2-ylpyrazol-3-yl]methyl]-2H-tetrazole.
What is the SMILES notation for 5-[[5-(3,5-dichlorophenoxy)-4-ethyl-1-propan-2-ylpyrazol-3-yl]methyl]-2H-tetrazole?
The canonical SMILES for 5-[[5-(3,5-dichlorophenoxy)-4-ethyl-1-propan-2-ylpyrazol-3-yl]methyl]-2H-tetrazole is CCc1c(Cc2nn[nH]n2)nn(C(C)C)c1Oc1cc(Cl)cc(Cl)c1.
What is the InChIKey of 5-[[5-(3,5-dichlorophenoxy)-4-ethyl-1-propan-2-ylpyrazol-3-yl]methyl]-2H-tetrazole?
The InChIKey is PYZQRDHNVMYZCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18Cl2N6O/c1-4-13-14(8-15-19-22-23-20-15)21-24(9(2)3)16(13)25-12-6-10(17)5-11(18)7-12/h5-7,9H,4,8H2,1-3H3,(H,19,20,22,23).
What are the key properties of 5-[[5-(3,5-dichlorophenoxy)-4-ethyl-1-propan-2-ylpyrazol-3-yl]methyl]-2H-tetrazole?
5-[[5-(3,5-dichlorophenoxy)-4-ethyl-1-propan-2-ylpyrazol-3-yl]methyl]-2H-tetrazole has a molecular weight of 381.27 g/mol, XLogP of 4.23, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[5-(3,5-dichlorophenoxy)-4-ethyl-1-propan-2-ylpyrazol-3-yl]methyl]-2H-tetrazole is sourced from PubChem (CID 58907117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).