C10H15NO — CID 58907249
[(1S,2S,3S,6R,7R)-4-azatricyclo[5.2.1.02,6]dec-8-en-3-yl]methanol (PubChem CID 58907249) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is [(1S,2S,3S,6R,7R)-4-azatricyclo[5.2.1.02,6]dec-8-en-3-yl]methanol.
| Compound Name | [(1S,2S,3S,6R,7R)-4-azatricyclo[5.2.1.02,6]dec-8-en-3-yl]methanol |
|---|---|
| PubChem CID | 58907249 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | [(1S,2S,3S,6R,7R)-4-azatricyclo[5.2.1.02,6]dec-8-en-3-yl]methanol |
| SMILES | OC[C@H]1NC[C@H]2[C@@H]1[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C10H15NO/c12-5-9-10-7-2-1-6(3-7)8(10)4-11-9/h1-2,6-12H,3-5H2/t6-,7+,8+,9+,10-/m0/s1 |
| InChIKey | ZQFHSFBQHDWKIO-CHHOWFRJSA-N |
| XLogP | 0.39 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|