C7H13NO2 — CID 58907301
[(3aS,4S,6aR)-3,3a,4,5,6,6a-hexahydro-1H-furo[3,4-c]pyrrol-4-yl]methanol (PubChem CID 58907301) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is [(3aS,4S,6aR)-3,3a,4,5,6,6a-hexahydro-1H-furo[3,4-c]pyrrol-4-yl]methanol.
| Compound Name | [(3aS,4S,6aR)-3,3a,4,5,6,6a-hexahydro-1H-furo[3,4-c]pyrrol-4-yl]methanol |
|---|---|
| PubChem CID | 58907301 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | [(3aS,4S,6aR)-3,3a,4,5,6,6a-hexahydro-1H-furo[3,4-c]pyrrol-4-yl]methanol |
| SMILES | OC[C@H]1NC[C@@H]2COC[C@@H]21 |
| InChI | InChI=1S/C7H13NO2/c9-2-7-6-4-10-3-5(6)1-8-7/h5-9H,1-4H2/t5-,6+,7-/m1/s1 |
| InChIKey | IMXQPIPCPQUMHE-DSYKOEDSSA-N |
| XLogP | -0.79 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |