About 2,3-ditert-butylthiirane 1-oxide
2,3-ditert-butylthiirane 1-oxide (PubChem CID 58907312) has the molecular formula C10H20OS
and a molecular weight of 188.34 g/mol. Its IUPAC name is 2,3-ditert-butylthiirane 1-oxide.
Molecular Properties
| Compound Name | 2,3-ditert-butylthiirane 1-oxide |
| PubChem CID | 58907312 |
| Molecular Formula | C10H20OS |
| Molecular Weight | 188.34 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 2,3-ditert-butylthiirane 1-oxide |
| SMILES | CC(C)(C)C1C(C(C)(C)C)S1=O |
| InChI | InChI=1S/C10H20OS/c1-9(2,3)7-8(12(7)11)10(4,5)6/h7-8H,1-6H3 |
| InChIKey | YGVOGJXPBKSMAX-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2,3-ditert-butylthiirane 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-ditert-butylthiirane 1-oxide?
The IUPAC name of 2,3-ditert-butylthiirane 1-oxide (CID 58907312) is 2,3-ditert-butylthiirane 1-oxide.
What is the SMILES notation for 2,3-ditert-butylthiirane 1-oxide?
The canonical SMILES for 2,3-ditert-butylthiirane 1-oxide is CC(C)(C)C1C(C(C)(C)C)S1=O.
What is the InChIKey of 2,3-ditert-butylthiirane 1-oxide?
The InChIKey is YGVOGJXPBKSMAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20OS/c1-9(2,3)7-8(12(7)11)10(4,5)6/h7-8H,1-6H3.
What are the key properties of 2,3-ditert-butylthiirane 1-oxide?
2,3-ditert-butylthiirane 1-oxide has a molecular weight of 188.34 g/mol, XLogP of 2.58, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-ditert-butylthiirane 1-oxide is sourced from PubChem (CID 58907312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).