C36H38N4O6 — CID 58907394
(E)-3-[4-[[1-[(3-cyclopentyl-1-methyl-2-pyridin-2-ylindole-6-carbonyl)amino]cyclobutanecarbonyl]amino]-2,6-dimethoxyphenyl]prop-2-enoic acid (PubChem CID 58907394) has the molecular formula C36H38N4O6 and a molecular weight of 622.72 g/mol. Its IUPAC name is (E)-3-[4-[[1-[(3-cyclopentyl-1-methyl-2-pyridin-2-ylindole-6-carbonyl)amino]cyclobutanecarbonyl]amino]-2,6-dimethoxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[1-[(3-cyclopentyl-1-methyl-2-pyridin-2-ylindole-6-carbonyl)amino]cyclobutanecarbonyl]amino]-2,6-dimethoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 58907394 |
| Molecular Formula | C36H38N4O6 |
| Molecular Weight | 622.72 g/mol |
| Exact Mass | 622.28 |
| IUPAC Name | (E)-3-[4-[[1-[(3-cyclopentyl-1-methyl-2-pyridin-2-ylindole-6-carbonyl)amino]cyclobutanecarbonyl]amino]-2,6-dimethoxyphenyl]prop-2-enoic acid |
| SMILES | COc1cc(NC(=O)C2(NC(=O)c3ccc4c(C5CCCC5)c(-c5ccccn5)n(C)c4c3)CCC2)cc(OC)c1/C=C/C(=O)O |
| InChI | InChI=1S/C36H38N4O6/c1-40-28-19-23(12-13-25(28)32(22-9-4-5-10-22)33(40)27-11-6-7-18-37-27)34(43)39-36(16-8-17-36)35(44)38-24-20-29(45-2)26(14-15-31(41)42)30(21-24)46-3/h6-7,11-15,18-22H,4-5,8-10,16-17H2,1-3H3,(H,38,44)(H,39,43)(H,41,42)/b15-14+ |
| InChIKey | KLGRZFDKJQHEFC-CCEZHUSRSA-N |
| XLogP | 6.30 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.72 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|