C30H37FN5O4+ — CID 58907985
[(2S,5R)-2,5-dimethylpiperazin-1-yl]-[5-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]-6-methoxy-1-methylindole-3-carbonyl]-oxoazanium (PubChem CID 58907985) has the molecular formula C30H37FN5O4+ and a molecular weight of 550.66 g/mol. Its IUPAC name is [(2S,5R)-2,5-dimethylpiperazin-1-yl]-[5-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]-6-methoxy-1-methylindole-3-carbonyl]-oxoazanium.
| Compound Name | [(2S,5R)-2,5-dimethylpiperazin-1-yl]-[5-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]-6-methoxy-1-methylindole-3-carbonyl]-oxoazanium |
|---|---|
| PubChem CID | 58907985 |
| Molecular Formula | C30H37FN5O4+ |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.28 |
| IUPAC Name | [(2S,5R)-2,5-dimethylpiperazin-1-yl]-[5-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]-6-methoxy-1-methylindole-3-carbonyl]-oxoazanium |
| SMILES | COc1cc2c(cc1C(=O)N1CCC(Cc3ccc(F)cc3)CC1)c(C(=O)[N+](=O)N1C[C@@H](C)NC[C@@H]1C)cn2C |
| InChI | InChI=1S/C30H37FN5O4/c1-19-17-35(20(2)16-32-19)36(39)30(38)26-18-33(3)27-15-28(40-4)25(14-24(26)27)29(37)34-11-9-22(10-12-34)13-21-5-7-23(31)8-6-21/h5-8,14-15,18-20,22,32H,9-13,16-17H2,1-4H3/q+1/t19-,20+/m1/s1 |
| InChIKey | NINONQOOCNGODC-UXHICEINSA-N |
| XLogP | 3.94 |
| TPSA | 86.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|