C28H31FN4O5 — CID 58907988
1-[5-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]-1-hydroxy-6-methoxyindol-3-yl]-2-piperazin-1-ylethane-1,2-dione (PubChem CID 58907988) has the molecular formula C28H31FN4O5 and a molecular weight of 522.58 g/mol. Its IUPAC name is 1-[5-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]-1-hydroxy-6-methoxyindol-3-yl]-2-piperazin-1-ylethane-1,2-dione.
| Compound Name | 1-[5-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]-1-hydroxy-6-methoxyindol-3-yl]-2-piperazin-1-ylethane-1,2-dione |
|---|---|
| PubChem CID | 58907988 |
| Molecular Formula | C28H31FN4O5 |
| Molecular Weight | 522.58 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | 1-[5-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]-1-hydroxy-6-methoxyindol-3-yl]-2-piperazin-1-ylethane-1,2-dione |
| SMILES | COc1cc2c(cc1C(=O)N1CCC(Cc3ccc(F)cc3)CC1)c(C(=O)C(=O)N1CCNCC1)cn2O |
| InChI | InChI=1S/C28H31FN4O5/c1-38-25-16-24-21(23(17-33(24)37)26(34)28(36)32-12-8-30-9-13-32)15-22(25)27(35)31-10-6-19(7-11-31)14-18-2-4-20(29)5-3-18/h2-5,15-17,19,30,37H,6-14H2,1H3 |
| InChIKey | XSERKXXBAHSASK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.58 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|