C26H27ClFN3O3 — CID 58907991
1-[6-chloro-5-[(2R,5S)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazine-1-carbonyl]-1-methylindol-3-yl]propane-1,2-dione (PubChem CID 58907991) has the molecular formula C26H27ClFN3O3 and a molecular weight of 483.97 g/mol. Its IUPAC name is 1-[6-chloro-5-[(2R,5S)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazine-1-carbonyl]-1-methylindol-3-yl]propane-1,2-dione.
| Compound Name | 1-[6-chloro-5-[(2R,5S)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazine-1-carbonyl]-1-methylindol-3-yl]propane-1,2-dione |
|---|---|
| PubChem CID | 58907991 |
| Molecular Formula | C26H27ClFN3O3 |
| Molecular Weight | 483.97 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | 1-[6-chloro-5-[(2R,5S)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazine-1-carbonyl]-1-methylindol-3-yl]propane-1,2-dione |
| SMILES | CC(=O)C(=O)c1cn(C)c2cc(Cl)c(C(=O)N3C[C@H](C)N(Cc4ccc(F)cc4)C[C@H]3C)cc12 |
| InChI | InChI=1S/C26H27ClFN3O3/c1-15-12-31(16(2)11-30(15)13-18-5-7-19(28)8-6-18)26(34)21-9-20-22(25(33)17(3)32)14-29(4)24(20)10-23(21)27/h5-10,14-16H,11-13H2,1-4H3/t15-,16+/m0/s1 |
| InChIKey | NBIBYCCZFGPNAG-JKSUJKDBSA-N |
| XLogP | 4.48 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.97 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|