C29H23F6O3S+ — CID 58908092
[4-(4-methylphenoxy)phenyl]-bis[4-(2,2,2-trifluoroethoxy)phenyl]sulfanium (PubChem CID 58908092) has the molecular formula C29H23F6O3S+ and a molecular weight of 565.56 g/mol. Its IUPAC name is [4-(4-methylphenoxy)phenyl]-bis[4-(2,2,2-trifluoroethoxy)phenyl]sulfanium.
| Compound Name | [4-(4-methylphenoxy)phenyl]-bis[4-(2,2,2-trifluoroethoxy)phenyl]sulfanium |
|---|---|
| PubChem CID | 58908092 |
| Molecular Formula | C29H23F6O3S+ |
| Molecular Weight | 565.56 g/mol |
| Exact Mass | 565.13 |
| IUPAC Name | [4-(4-methylphenoxy)phenyl]-bis[4-(2,2,2-trifluoroethoxy)phenyl]sulfanium |
| SMILES | Cc1ccc(Oc2ccc([S+](c3ccc(OCC(F)(F)F)cc3)c3ccc(OCC(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C29H23F6O3S/c1-20-2-4-23(5-3-20)38-24-10-16-27(17-11-24)39(25-12-6-21(7-13-25)36-18-28(30,31)32)26-14-8-22(9-15-26)37-19-29(33,34)35/h2-17H,18-19H2,1H3/q+1 |
| InChIKey | MEJVLHCGTNGDAT-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.56 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|