About N-(3H-1,2-benzodithiol-5-ylmethylidene)pyridazine-4-sulfonamide
N-(3H-1,2-benzodithiol-5-ylmethylidene)pyridazine-4-sulfonamide (PubChem CID 58908169) has the molecular formula C12H9N3O2S3
and a molecular weight of 323.42 g/mol. Its IUPAC name is N-(3H-1,2-benzodithiol-5-ylmethylidene)pyridazine-4-sulfonamide.
Molecular Properties
| Compound Name | N-(3H-1,2-benzodithiol-5-ylmethylidene)pyridazine-4-sulfonamide |
| PubChem CID | 58908169 |
| Molecular Formula | C12H9N3O2S3 |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 322.99 |
| IUPAC Name | N-(3H-1,2-benzodithiol-5-ylmethylidene)pyridazine-4-sulfonamide |
| SMILES | O=S(=O)(N=Cc1ccc2c(c1)CSS2)c1ccnnc1 |
| InChI | InChI=1S/C12H9N3O2S3/c16-20(17,11-3-4-13-14-7-11)15-6-9-1-2-12-10(5-9)8-18-19-12/h1-7H,8H2 |
| InChIKey | FDOCNXJVQXEKSO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 72.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(3H-1,2-benzodithiol-5-ylmethylidene)pyridazine-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3H-1,2-benzodithiol-5-ylmethylidene)pyridazine-4-sulfonamide?
The IUPAC name of N-(3H-1,2-benzodithiol-5-ylmethylidene)pyridazine-4-sulfonamide (CID 58908169) is N-(3H-1,2-benzodithiol-5-ylmethylidene)pyridazine-4-sulfonamide.
What is the SMILES notation for N-(3H-1,2-benzodithiol-5-ylmethylidene)pyridazine-4-sulfonamide?
The canonical SMILES for N-(3H-1,2-benzodithiol-5-ylmethylidene)pyridazine-4-sulfonamide is O=S(=O)(N=Cc1ccc2c(c1)CSS2)c1ccnnc1.
What is the InChIKey of N-(3H-1,2-benzodithiol-5-ylmethylidene)pyridazine-4-sulfonamide?
The InChIKey is FDOCNXJVQXEKSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N3O2S3/c16-20(17,11-3-4-13-14-7-11)15-6-9-1-2-12-10(5-9)8-18-19-12/h1-7H,8H2.
What are the key properties of N-(3H-1,2-benzodithiol-5-ylmethylidene)pyridazine-4-sulfonamide?
N-(3H-1,2-benzodithiol-5-ylmethylidene)pyridazine-4-sulfonamide has a molecular weight of 323.42 g/mol, XLogP of 2.54, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3H-1,2-benzodithiol-5-ylmethylidene)pyridazine-4-sulfonamide is sourced from PubChem (CID 58908169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).