C22H44O2Si — CID 58908330
(5S)-5-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]hexan-1-ol (PubChem CID 58908330) has the molecular formula C22H44O2Si and a molecular weight of 368.68 g/mol. Its IUPAC name is (5S)-5-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]hexan-1-ol.
| Compound Name | (5S)-5-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]hexan-1-ol |
|---|---|
| PubChem CID | 58908330 |
| Molecular Formula | C22H44O2Si |
| Molecular Weight | 368.68 g/mol |
| Exact Mass | 368.31 |
| IUPAC Name | (5S)-5-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]hexan-1-ol |
| SMILES | C[C@@H](CCCCO)[C@H]1CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C22H44O2Si/c1-17(11-8-9-16-23)18-13-14-19-20(12-10-15-22(18,19)5)24-25(6,7)21(2,3)4/h17-20,23H,8-16H2,1-7H3/t17-,18+,19-,20-,22+/m0/s1 |
| InChIKey | UCURMOIWONMFTD-UTNFEIGLSA-N |
| XLogP | 6.39 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.68 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|