C30H47N3O7 — CID 58908366
methyl 3-[[(1R,2S,5S)-3-[(2S)-2-cyclohexyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-2-oxooct-7-enoate (PubChem CID 58908366) has the molecular formula C30H47N3O7 and a molecular weight of 561.72 g/mol. Its IUPAC name is methyl 3-[[(1R,2S,5S)-3-[(2S)-2-cyclohexyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-2-oxooct-7-enoate.
| Compound Name | methyl 3-[[(1R,2S,5S)-3-[(2S)-2-cyclohexyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-2-oxooct-7-enoate |
|---|---|
| PubChem CID | 58908366 |
| Molecular Formula | C30H47N3O7 |
| Molecular Weight | 561.72 g/mol |
| Exact Mass | 561.34 |
| IUPAC Name | methyl 3-[[(1R,2S,5S)-3-[(2S)-2-cyclohexyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-2-oxooct-7-enoate |
| SMILES | C=CCCCC(NC(=O)[C@@H]1[C@@H]2[C@H](CN1C(=O)[C@@H](NC(=O)OC(C)(C)C)C1CCCCC1)C2(C)C)C(=O)C(=O)OC |
| InChI | InChI=1S/C30H47N3O7/c1-8-9-11-16-20(24(34)27(37)39-7)31-25(35)23-21-19(30(21,5)6)17-33(23)26(36)22(18-14-12-10-13-15-18)32-28(38)40-29(2,3)4/h8,18-23H,1,9-17H2,2-7H3,(H,31,35)(H,32,38)/t19-,20?,21-,22-,23-/m0/s1 |
| InChIKey | INKXLOOYEIODHO-KLYMBLKMSA-N |
| XLogP | 3.53 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.72 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|