C25H31F2N5O2 — CID 58909446
N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[5-(2-methylpropyl)-2-(1,2,4-triazol-1-yl)phenyl]methylamino]butan-2-yl]acetamide (PubChem CID 58909446) has the molecular formula C25H31F2N5O2 and a molecular weight of 471.55 g/mol. Its IUPAC name is N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[5-(2-methylpropyl)-2-(1,2,4-triazol-1-yl)phenyl]methylamino]butan-2-yl]acetamide.
| Compound Name | N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[5-(2-methylpropyl)-2-(1,2,4-triazol-1-yl)phenyl]methylamino]butan-2-yl]acetamide |
|---|---|
| PubChem CID | 58909446 |
| Molecular Formula | C25H31F2N5O2 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[5-(2-methylpropyl)-2-(1,2,4-triazol-1-yl)phenyl]methylamino]butan-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](Cc1cc(F)cc(F)c1)[C@H](O)CNCc1cc(CC(C)C)ccc1-n1cncn1 |
| InChI | InChI=1S/C25H31F2N5O2/c1-16(2)6-18-4-5-24(32-15-29-14-30-32)20(7-18)12-28-13-25(34)23(31-17(3)33)10-19-8-21(26)11-22(27)9-19/h4-5,7-9,11,14-16,23,25,28,34H,6,10,12-13H2,1-3H3,(H,31,33)/t23-,25+/m0/s1 |
| InChIKey | QQSBZBHLCVBOMN-UKILVPOCSA-N |
| XLogP | 2.94 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |