C27H36F2N2O2 — CID 58909467
N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[[(1S)-7-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-3-hydroxybutan-2-yl]pentanamide (PubChem CID 58909467) has the molecular formula C27H36F2N2O2 and a molecular weight of 458.59 g/mol. Its IUPAC name is N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[[(1S)-7-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-3-hydroxybutan-2-yl]pentanamide.
| Compound Name | N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[[(1S)-7-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-3-hydroxybutan-2-yl]pentanamide |
|---|---|
| PubChem CID | 58909467 |
| Molecular Formula | C27H36F2N2O2 |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[[(1S)-7-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-3-hydroxybutan-2-yl]pentanamide |
| SMILES | CCCCC(=O)N[C@@H](Cc1cc(F)cc(F)c1)[C@H](O)CN[C@H]1CCCc2ccc(CC)cc21 |
| InChI | InChI=1S/C27H36F2N2O2/c1-3-5-9-27(33)31-25(15-19-12-21(28)16-22(29)13-19)26(32)17-30-24-8-6-7-20-11-10-18(4-2)14-23(20)24/h10-14,16,24-26,30,32H,3-9,15,17H2,1-2H3,(H,31,33)/t24-,25-,26+/m0/s1 |
| InChIKey | KHSODSMCXNBSRT-KKUQBAQOSA-N |
| XLogP | 4.77 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |