C25H29ClN2O4 — CID 58909652
methyl 2-[4-[4-(4-chloro-2,7,7-trimethylpyrano[2,3-d]pyrimidin-6-yl)phenyl]cyclohexyl]ethaneperoxoate (PubChem CID 58909652) has the molecular formula C25H29ClN2O4 and a molecular weight of 456.97 g/mol. Its IUPAC name is methyl 2-[4-[4-(4-chloro-2,7,7-trimethylpyrano[2,3-d]pyrimidin-6-yl)phenyl]cyclohexyl]ethaneperoxoate.
| Compound Name | methyl 2-[4-[4-(4-chloro-2,7,7-trimethylpyrano[2,3-d]pyrimidin-6-yl)phenyl]cyclohexyl]ethaneperoxoate |
|---|---|
| PubChem CID | 58909652 |
| Molecular Formula | C25H29ClN2O4 |
| Molecular Weight | 456.97 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | methyl 2-[4-[4-(4-chloro-2,7,7-trimethylpyrano[2,3-d]pyrimidin-6-yl)phenyl]cyclohexyl]ethaneperoxoate |
| SMILES | COOC(=O)CC1CCC(c2ccc(C3=Cc4c(Cl)nc(C)nc4OC3(C)C)cc2)CC1 |
| InChI | InChI=1S/C25H29ClN2O4/c1-15-27-23(26)20-14-21(25(2,3)31-24(20)28-15)19-11-9-18(10-12-19)17-7-5-16(6-8-17)13-22(29)32-30-4/h9-12,14,16-17H,5-8,13H2,1-4H3 |
| InChIKey | AIMZISVOIYRMND-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.97 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|