C23H33BO4 — CID 58909731
methyl 2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,2-dihydroindene-3,4'-cyclohexane]-1'-yl]acetate (PubChem CID 58909731) has the molecular formula C23H33BO4 and a molecular weight of 384.33 g/mol. Its IUPAC name is methyl 2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,2-dihydroindene-3,4'-cyclohexane]-1'-yl]acetate.
| Compound Name | methyl 2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,2-dihydroindene-3,4'-cyclohexane]-1'-yl]acetate |
|---|---|
| PubChem CID | 58909731 |
| Molecular Formula | C23H33BO4 |
| Molecular Weight | 384.33 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | methyl 2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,2-dihydroindene-3,4'-cyclohexane]-1'-yl]acetate |
| SMILES | COC(=O)CC1CCC2(CCc3cc(B4OC(C)(C)C(C)(C)O4)ccc32)CC1 |
| InChI | InChI=1S/C23H33BO4/c1-21(2)22(3,4)28-24(27-21)18-6-7-19-17(15-18)10-13-23(19)11-8-16(9-12-23)14-20(25)26-5/h6-7,15-16H,8-14H2,1-5H3 |
| InChIKey | GCSBGKOXCXCUTL-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.33 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|