About US20240150293, Example 64
US20240150293, Example 64 (PubChem CID 58909873) has the molecular formula C16H18O2
and a molecular weight of 242.32 g/mol.
Molecular Properties
| Compound Name | US20240150293, Example 64 |
| PubChem CID | 58909873 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | — |
| SMILES | C1=CC2(CCC3(CC2)OCCO3)c2ccccc21 |
| InChI | InChI=1S/C16H18O2/c1-2-4-14-13(3-1)5-6-15(14)7-9-16(10-8-15)17-11-12-18-16/h1-6H,7-12H2 |
| InChIKey | XEDKKOYOEPKZCX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze US20240150293, Example 64 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of US20240150293, Example 64?
The IUPAC name of US20240150293, Example 64 (CID 58909873) is not available.
What is the SMILES notation for US20240150293, Example 64?
The canonical SMILES for US20240150293, Example 64 is C1=CC2(CCC3(CC2)OCCO3)c2ccccc21.
What is the InChIKey of US20240150293, Example 64?
The InChIKey is XEDKKOYOEPKZCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18O2/c1-2-4-14-13(3-1)5-6-15(14)7-9-16(10-8-15)17-11-12-18-16/h1-6H,7-12H2.
What are the key properties of US20240150293, Example 64?
US20240150293, Example 64 has a molecular weight of 242.32 g/mol, XLogP of 3.27, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for US20240150293, Example 64 is sourced from PubChem (CID 58909873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).