C29H31F3N6O5 — CID 58909987
6-[2-[8-tert-butyl-4-(cyanomethyl)-2,3-dihydro-1,4-benzoxazin-6-yl]-2-oxoethyl]-3-ethoxy-N-methyl-7-(2,2,2-trifluoroacetyl)imino-5H-pyrrolo[3,4-b]pyridine-2-carboxamide (PubChem CID 58909987) has the molecular formula C29H31F3N6O5 and a molecular weight of 600.60 g/mol. Its IUPAC name is 6-[2-[8-tert-butyl-4-(cyanomethyl)-2,3-dihydro-1,4-benzoxazin-6-yl]-2-oxoethyl]-3-ethoxy-N-methyl-7-(2,2,2-trifluoroacetyl)imino-5H-pyrrolo[3,4-b]pyridine-2-carboxamide.
| Compound Name | 6-[2-[8-tert-butyl-4-(cyanomethyl)-2,3-dihydro-1,4-benzoxazin-6-yl]-2-oxoethyl]-3-ethoxy-N-methyl-7-(2,2,2-trifluoroacetyl)imino-5H-pyrrolo[3,4-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 58909987 |
| Molecular Formula | C29H31F3N6O5 |
| Molecular Weight | 600.60 g/mol |
| Exact Mass | 600.23 |
| IUPAC Name | 6-[2-[8-tert-butyl-4-(cyanomethyl)-2,3-dihydro-1,4-benzoxazin-6-yl]-2-oxoethyl]-3-ethoxy-N-methyl-7-(2,2,2-trifluoroacetyl)imino-5H-pyrrolo[3,4-b]pyridine-2-carboxamide |
| SMILES | CCOc1cc2c(nc1C(=O)NC)/C(=N\C(=O)C(F)(F)F)N(CC(=O)c1cc3c(c(C(C)(C)C)c1)OCCN3CC#N)C2 |
| InChI | InChI=1S/C29H31F3N6O5/c1-6-42-21-13-17-14-38(25(36-27(41)29(30,31)32)22(17)35-23(21)26(40)34-5)15-20(39)16-11-18(28(2,3)4)24-19(12-16)37(8-7-33)9-10-43-24/h11-13H,6,8-10,14-15H2,1-5H3,(H,34,40)/b36-25+ |
| InChIKey | OSKNOHQQIXVJPX-YRRMYEEHSA-N |
| XLogP | 3.39 |
| TPSA | 137.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.60 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|