C28H28F3N5O3 — CID 58910023
N-[6-[2-[8-tert-butyl-4-(cyanomethyl)-2,3-dihydro-1,4-benzoxazin-6-yl]-2-oxoethyl]-2-cyclopropyl-5H-pyrrolo[3,4-b]pyridin-7-ylidene]-2,2,2-trifluoroacetamide (PubChem CID 58910023) has the molecular formula C28H28F3N5O3 and a molecular weight of 539.56 g/mol. Its IUPAC name is N-[6-[2-[8-tert-butyl-4-(cyanomethyl)-2,3-dihydro-1,4-benzoxazin-6-yl]-2-oxoethyl]-2-cyclopropyl-5H-pyrrolo[3,4-b]pyridin-7-ylidene]-2,2,2-trifluoroacetamide.
| Compound Name | N-[6-[2-[8-tert-butyl-4-(cyanomethyl)-2,3-dihydro-1,4-benzoxazin-6-yl]-2-oxoethyl]-2-cyclopropyl-5H-pyrrolo[3,4-b]pyridin-7-ylidene]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 58910023 |
| Molecular Formula | C28H28F3N5O3 |
| Molecular Weight | 539.56 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | N-[6-[2-[8-tert-butyl-4-(cyanomethyl)-2,3-dihydro-1,4-benzoxazin-6-yl]-2-oxoethyl]-2-cyclopropyl-5H-pyrrolo[3,4-b]pyridin-7-ylidene]-2,2,2-trifluoroacetamide |
| SMILES | CC(C)(C)c1cc(C(=O)CN2Cc3ccc(C4CC4)nc3/C2=N\C(=O)C(F)(F)F)cc2c1OCCN2CC#N |
| InChI | InChI=1S/C28H28F3N5O3/c1-27(2,3)19-12-18(13-21-24(19)39-11-10-35(21)9-8-32)22(37)15-36-14-17-6-7-20(16-4-5-16)33-23(17)25(36)34-26(38)28(29,30)31/h6-7,12-13,16H,4-5,9-11,14-15H2,1-3H3/b34-25+ |
| InChIKey | DIZCAOPLHOSDQC-YQCHCMBFSA-N |
| XLogP | 4.51 |
| TPSA | 98.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.56 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|