C36H34F6N4O3 — CID 58910082
tert-butyl 3-[[(3R,9aR)-2-[3,5-bis(trifluoromethyl)benzoyl]-7-pyridin-4-yl-1,3,4,8,9,9a-hexahydropyrido[1,2-a]pyrazin-3-yl]methyl]indole-1-carboxylate (PubChem CID 58910082) has the molecular formula C36H34F6N4O3 and a molecular weight of 684.68 g/mol. Its IUPAC name is tert-butyl 3-[[(3R,9aR)-2-[3,5-bis(trifluoromethyl)benzoyl]-7-pyridin-4-yl-1,3,4,8,9,9a-hexahydropyrido[1,2-a]pyrazin-3-yl]methyl]indole-1-carboxylate.
| Compound Name | tert-butyl 3-[[(3R,9aR)-2-[3,5-bis(trifluoromethyl)benzoyl]-7-pyridin-4-yl-1,3,4,8,9,9a-hexahydropyrido[1,2-a]pyrazin-3-yl]methyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 58910082 |
| Molecular Formula | C36H34F6N4O3 |
| Molecular Weight | 684.68 g/mol |
| Exact Mass | 684.25 |
| IUPAC Name | tert-butyl 3-[[(3R,9aR)-2-[3,5-bis(trifluoromethyl)benzoyl]-7-pyridin-4-yl-1,3,4,8,9,9a-hexahydropyrido[1,2-a]pyrazin-3-yl]methyl]indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(C[C@@H]2CN3C=C(c4ccncc4)CC[C@@H]3CN2C(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2ccccc21 |
| InChI | InChI=1S/C36H34F6N4O3/c1-34(2,3)49-33(48)46-19-25(30-6-4-5-7-31(30)46)16-29-20-44-18-23(22-10-12-43-13-11-22)8-9-28(44)21-45(29)32(47)24-14-26(35(37,38)39)17-27(15-24)36(40,41)42/h4-7,10-15,17-19,28-29H,8-9,16,20-21H2,1-3H3/t28-,29-/m1/s1 |
| InChIKey | IPSXPFBZCWKZDA-FQLXRVMXSA-N |
| XLogP | 8.43 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.68 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |