C34H39F6N3O3Sn — CID 58910083
tert-butyl 3-[[(3R,9aR)-2-[3,5-bis(trifluoromethyl)benzoyl]-7-trimethylstannyl-1,3,4,8,9,9a-hexahydropyrido[1,2-a]pyrazin-3-yl]methyl]indole-1-carboxylate (PubChem CID 58910083) has the molecular formula C34H39F6N3O3Sn and a molecular weight of 770.40 g/mol. Its IUPAC name is tert-butyl 3-[[(3R,9aR)-2-[3,5-bis(trifluoromethyl)benzoyl]-7-trimethylstannyl-1,3,4,8,9,9a-hexahydropyrido[1,2-a]pyrazin-3-yl]methyl]indole-1-carboxylate.
| Compound Name | tert-butyl 3-[[(3R,9aR)-2-[3,5-bis(trifluoromethyl)benzoyl]-7-trimethylstannyl-1,3,4,8,9,9a-hexahydropyrido[1,2-a]pyrazin-3-yl]methyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 58910083 |
| Molecular Formula | C34H39F6N3O3Sn |
| Molecular Weight | 770.40 g/mol |
| Exact Mass | 771.19 |
| IUPAC Name | tert-butyl 3-[[(3R,9aR)-2-[3,5-bis(trifluoromethyl)benzoyl]-7-trimethylstannyl-1,3,4,8,9,9a-hexahydropyrido[1,2-a]pyrazin-3-yl]methyl]indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(C[C@@H]2CN3C=C([Sn](C)(C)C)CC[C@@H]3CN2C(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2ccccc21 |
| InChI | InChI=1S/C31H30F6N3O3.3CH3.Sn/c1-29(2,3)43-28(42)40-16-20(25-9-4-5-10-26(25)40)14-24-17-38-11-7-6-8-23(38)18-39(24)27(41)19-12-21(30(32,33)34)15-22(13-19)31(35,36)37;;;;/h4-5,9-13,15-16,23-24H,6,8,14,17-18H2,1-3H3;3*1H3;/t23-,24-;;;;/m1..../s1 |
| InChIKey | ATOALHGYFZWQFV-PIJQHSLXSA-N |
| XLogP | 8.75 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.40 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |