C35H33F6N5O3 — CID 58910084
tert-butyl 3-[[(3R,9aR)-2-[3,5-bis(trifluoromethyl)benzoyl]-7-pyrazin-2-yl-1,3,4,6,9,9a-hexahydropyrido[1,2-a]pyrazin-3-yl]methyl]indole-1-carboxylate (PubChem CID 58910084) has the molecular formula C35H33F6N5O3 and a molecular weight of 685.67 g/mol. Its IUPAC name is tert-butyl 3-[[(3R,9aR)-2-[3,5-bis(trifluoromethyl)benzoyl]-7-pyrazin-2-yl-1,3,4,6,9,9a-hexahydropyrido[1,2-a]pyrazin-3-yl]methyl]indole-1-carboxylate.
| Compound Name | tert-butyl 3-[[(3R,9aR)-2-[3,5-bis(trifluoromethyl)benzoyl]-7-pyrazin-2-yl-1,3,4,6,9,9a-hexahydropyrido[1,2-a]pyrazin-3-yl]methyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 58910084 |
| Molecular Formula | C35H33F6N5O3 |
| Molecular Weight | 685.67 g/mol |
| Exact Mass | 685.25 |
| IUPAC Name | tert-butyl 3-[[(3R,9aR)-2-[3,5-bis(trifluoromethyl)benzoyl]-7-pyrazin-2-yl-1,3,4,6,9,9a-hexahydropyrido[1,2-a]pyrazin-3-yl]methyl]indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(C[C@@H]2CN3CC(c4cnccn4)=CC[C@@H]3CN2C(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2ccccc21 |
| InChI | InChI=1S/C35H33F6N5O3/c1-33(2,3)49-32(48)46-18-23(28-6-4-5-7-30(28)46)14-27-19-44-17-21(29-16-42-10-11-43-29)8-9-26(44)20-45(27)31(47)22-12-24(34(36,37)38)15-25(13-22)35(39,40)41/h4-8,10-13,15-16,18,26-27H,9,14,17,19-20H2,1-3H3/t26-,27-/m1/s1 |
| InChIKey | RUEHFAHDLUIOEH-KAYWLYCHSA-N |
| XLogP | 7.48 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.67 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |